Ibotenic Acid

Ibotenic acid is a neuroexcitatory amino acid originally isolated from Amanita species that functions as a NMDA and metabotropic glutamate receptor agonist. As a neurotoxin, ibotenic acid is often used to induce brain lesions in animals that model cognitive dysfunctions resulting from neurodegenerative diseases, traumatic brain injury, and stroke.Formal Name: alpha-amino-2,3-dihydro-3-oxo-5-isoxazoleacetic acid. CAS Number: 2552-55-8. Synonyms: (±)-Ibotenic Acid, IBO, NSC 204850. Molecular Formula: C5H6N2O4. Formula Weight: 158.1. Purity: >98%. Formulation: (Request formulation change), A solid. Solubility: Water: 10 mM. SMILES: O=C1C=C(C(C(O)=O)N)ON1. InChi Code: InChI=1S/C5H6N2O4/c6-4(5(9)10)2-1-3(8)7-11-2/h1,4H,6H2,(H,7,8)(H,9,10). InChi Key: IRJCBFDCFXCWGO-UHFFFAOYSA-N.