Hygromycin B

Description: Hygromycin B (Hygrovetine) is an aminoglycoside antibiotic that inhibits protein synthesis by interfering with translocation and causing mistranslation of the 70S ribosome. Hygromycin B can be used to screen prokaryotic or eukaryotic cells transfected with hph or hyg resistance genes. Target: Antibacterial, Antifungal, Antibiotic, ribosome. Smiles: CN[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@@H]3O[C@@]4(O[C@H]23)O[C@H]([C@H](N)CO)[C@H](O)[C@H](O)[C@H]4O)[C@@H]1O. References: Fan M, et al. UDP-glucose dehydrogenase supports autophagy-deficient PDAC growth via increasing hyaluronic acid biosynthesis. Cell Rep. 2024 Feb 16,43(2):113808.