Heronamide C

Description: Heronamide C, a polyketide macrolactam antifungal agent synthesized by marine Actinomycetes, exhibits selective toxicity by inhibiting growth and promoting abnormal cell wall material accumulation in wild-type fission yeast cells (MIC = 0.13-0.28 µM), without affecting Gram-positive bacteria or human cancer cell lines, HeLa and MDA-MB-231. At 20 µM, it triggers reversible morphological alterations, notably the development of large intracellular structures, in HeLa cells. Target: Others. Smiles: [H][C@@]1(C\C=C\C=C\CCC)C\C=C\C=C(/C)\C=C\C=C/[C@H](O)[C@H](O)\C=C(/C)\C=C\C=C\C(=O)N1