Gypsetin

Description: Gypsetin inhibits the activity of acyl-CoA:cholesterol acyltransferase (ACAT), showing inhibitory effects on rat liver microsomal ACAT with an IC50 of 18 µM, and competes with oleoyl-CoA substrate, possessing a Ki value of 5.5 µM. Additionally, Gypsetin prevents the formation of cholesterol esters from oleic acid with an IC50 of 0.65 µM. Target: Acyltransferase. Smiles: [C@@](C=C)(C)(C)[C@]12[C@](O)(C=3C(N1)=CC=CC3)C[C@@]4(N2C(=O)[C@]5(N(C4=O)[C@]6(C(C=C)(C)C)[C@](O)(C5)C=7C(N6)=CC=CC7)[H])[H]