Funalenone

Description: Funalenone is a phenalenone originally isolated from A. niger. It inhibits HIV-1 integrase (IC50 = 10 µM) and HIV-1 replication in human peripheral blood cells transformed by murine leukemia virus (HPB-M(a), IC50 = 1.7 µM) but is less cytotoxic to mammalian HPB-M(a) cells (IC50 = 87 µM). Funalenone selectively inhibits matrix metalloproteinase-1 (MMP-1, IC50 = 170 µM) over MMP-2 and MMP-9, which it inhibits by 18.3 and 38.2%, respectively, when used at a concentration of 400 µM. It also inhibits the bacterial cell wall synthesis enzymes MraY and MurG (IC50s = 25.5 µM in a membrane plate assay) and inhibits growth of S. aureus with a MIC value of 64 µg/mL. Target: Others. Smiles: COC1=C(O)c2c(O)cc(C)c3c(O)cc(O)c(C1=O)c23 , c:2,