Funalenone

Funalenone is a phenalenone originally isolated from A. niger. It inhibits HIV-1 integrase (IC50 = 10 µM) and HIV-1 replication in human peripheral blood cells transformed by murine leukemia virus (HPB-M(a), IC50 = 1.7 µM) but is less cytotoxic to mammalian HPB-M(a) cells (IC50 = 87 µM). Funalenone selectively inhibits matrix metalloproteinase-1 (MMP-1, IC50 = 170 µM) over MMP-2 and MMP-9, which it inhibits by 18.3 and 38.2%, respectively, when used at a concentration of 400 µM. It also inhibits the bacterial cell wall synthesis enzymes MraY and MurG (IC50s = 25.5 µM in a membrane plate assay) and inhibits growth of S. aureus with a MIC value of 64 µg/mL.Formal Name: 3,4,7,9-tetrahydroxy-2-methoxy-6-methyl-1H-phenalen-1-one. CAS Number: 259728-61-5. Molecular Formula: C15H12O6. Formula Weight: 288.3. Purity: >95%. Formulation: (Request formulation change), A solid. Solubility: Chloroform: soluble, DMSO: soluble, Methanol: soluble. SMILES: O=C1C(OC)=C(O)C2=C(O)C=C(C)C3=C2C1=C(O)C=C3O. InChi Code: InChI=1S/C15H12O6/c1-5-3-6(16)10-12-9(5)7(17)4-8(18)11(12)14(20)15(21-2)13(10)19/h3-4,16-19H,1-2H3. InChi Key: QAPJKCNKHLDDAK-UHFFFAOYSA-N.