Fmoc-L-Tyr(2-azidoethyl)-OH

Description: Fmoc-L-Tyr(2-azidoethyl)-OH is a click chemistry reagent featuring an azido group. This synthetic derivative of tyrosine, protected by an Fmoc group, includes an azidoethyl substituent functioning as a reactive handle for dual orthogonal conjugation via Cu(I)-catalyzed 1,3-dipolar cycloaddition with alkynes. Additionally, the azido group can serve as an IR reporting molecule. Target: ADC Linker. Smiles: C(OC(N[C@@H](CC1=CC=C(OCCN=[N+]=[N-])C=C1)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3