EN460

EN460 is an inhibitor of ERO1-like protein alpha (ERO1alpha, IC50 = 1. µM). It also inhibits additional FAD-containing enzymes, including monoamine oxidase A (MAO-A), MAO-B, and lysine-specific demethylase 1 (LSD1, IC50s = 7. 30. and 4. µM, respectively). EN460 (25 µM) induces endoplasmic reticulum (ER) stress and apoptosis in U266 multiple myeloma cells. It inhibits hypoxia-induced apoptosis in HT22 cells when used at a concentration of 10 µM. In vivo, EN460 increases survival and decreases the number of intrahepatic metastases in a Panc02 murine pancreatic ductal adenocarcinoma (PDAC) model. It inhibits isoproterenol-induced ventricular fibrillation in a rat model of cardiac hypertrophy induced by thoracic aortic banding. InChI: InChI=1S/C22H12ClF3N2O4/c23-17-8-6-13(10-15(17)21(30)31)28-20(29)16(19(27-28)22(24,25)26)11-14-7-9-18(32-14)12-4-2-1-3-5-12/h1-11H,(H,30,31) InChIKey: RSLFQCNAOMQAIH-UHFFFAOYSA-N SMILES: O=C(N(C1=CC(C(O)=O)=C(Cl)C=C1)N=C2C(F)(F)F)C2=CC3=CC=C(C4=CC=CC=C4)O3