DMNQ

DMNQ is a 1,4-naphthoquinone that acts as a redox-cycling agent, typically increasing intracellular superoxide and hydrogen peroxide formation. The amount of oxidative stress is proportional to the amount of DMNQ applied and can alter diverse cellular parameters, including signal transduction, mitochondrial function, and gene expression.Formal Name: 2,3-dimethoxy-1,4-naphthalenedione. CAS Number: 6956-96-3. Synonyms: NSC 69355. Molecular Formula: C12H10O4. Formula Weight: 218.2. Purity: >99%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMSO: Soluble, Methanol: Soluble. SMILES: O=C1C(OC)=C(OC)C(C2=CC=CC=C21)=O. InChi Code: InChI=1S/C12H10O4/c1-15-11-9(13)7-5-3-4-6-8(7)10(14)12(11)16-2/h3-6H,1-2H3. InChi Key: ZEGDFCCYTFPECB-UHFFFAOYSA-N.