DiSBAC10

Description: DiSBAC10, a voltage-sensitive fluorescent probe, facilitates cell membrane electrical activity investigation in FRET assays. At rest, it populates the membrane's outer leaflet, accepting photons from excited fluorescein-labeled proteins and emitting them at higher wavelengths. Upon cell depolarization, DiSBAC10 quickly translocates to the inner leaflet, increasing fluorophore separation and diminishing the FRET signal. Smiles: O=C1C(=CC=CC2C(=O)N(C(=S)N(C2=O)CCCCCCCCCC)CCCCCCCCCC)C(=O)N(C(=S)N1CCCCCCCCCC)CCCCCCCCCC