DecarboxyBiotin-Alkyne

Description: DecarboxyBiotin-Alkyne is a click chemistry reagent featuring an alkyne group. Click chemistry is extensively applied in the coupling of nucleic acids, lipids, proteins, and other molecules due to its beneficial properties such as high yield, high specificity, and simplicity, making it invaluable across various research domains. Target: ADC Linker. Smiles: C(CCCCC#C)[C@H]1[C@@]2([C@@](NC(=O)N2)(CS1)[H])[H]