Debio 0617B

Description: Debio 0617B is a multi-kinase inhibitor that reduces maintenance and self-renewal of primary human AML CD34+ stem/progenitor cells. debio 0617B targets key kinases upstream of STAT3/STAT5 signalling, such as JAK, ABL, SRC and class III/V receptor tyrosine kinases. debio 0617B can be used to study STAT3 driven solid tumours. Target: Others. Smiles: ClC=1C(N2CC=3C(CC2)=NC(NC4=CC=C(C(NC)=O)C=C4)=NC3)=CC(NC(=O)C5=CC(C(F)(F)F)=CC=N5)=CC1