Chaetoviridin A

Description: Chaetoviridin A, an azaphilone isolated from Chaetomium globosum, is characterized as 6H-furo[2,3-h]isochromene-6,8(6aH)-dione with substitutions including a chloro group at position 5, a 3-hydroxy-2-methylbutanoyl group at position 9, a methyl group at position 6a, and a 3-methylpent-1-en-1yl group at position 3. It exhibits antifungal activity against plant pathogenic fungi. Target: Others. Smiles: C[C@]12C(C=3C(=C(Cl)C1=O)C=C(/C=C/[C@H](CC)C)OC3)=C(C([C@@H]([C@@H](C)O)C)=O)C(=O)O2