Campesterol

Description: Campesterol ((24R)-5-Ergosten-3beta-ol) is a plant sterol with cholesterol lowering and anticarcinogenic effects, it and other plant sterols often decrease LDL cholesterol levels overall. Campesterol has anti-inflammatory effect, it inhibits several pro-inflammatory and matrix degradation mediators typically involved in osteoarthritis- induced cartilage degradation, also sometimes used to treat some specific prostate conditions. Target: Endogenous Metabolite. Smiles: [H][C@@]12CC[C@H]([C@H](C)CC[C@@H](C)C(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C