BMS 466442

An Asc-1 inhibitor, selectively inhibits Asc-1 in HEK293 cells expressing Asc-1 (IC50 = 36.8 nM) over 40 other transporters (IC50s = >10 µM), inhibits serine, cysteine, glycine, and alanine import and cAMP-induced increases in the OCR and decreases UCP1 levels in primary human white and brown adipose cells at 100 nM, decreases the number of malformed neurons and reduces contextual fear memory deficits in a mouse model of surgery-induced brain damage when intracerebroventricularly infused. Formulation: A solid. InChI: InChI=1S/C31H30N4O5/c1-38-28-14-23-13-26(33-25(23)16-29(28)40-19-22-11-7-4-8-12-22)30(36)34-27(31(37)39-2)15-24-18-35(20-32-24)17-21-9-5-3-6-10-21/h3-14,16,18,20,27,33H,15,17,19H2,1-2H3,(H,34,36)/t27-/m0/s1. InChIKey: UUCAHZCMRZOTNF-MHZLTWQESA-N. SMILES: O=C(C1=CC(C(N1)=C2)=CC(OC)=C2OCC3=CC=CC=C3)N[C@H](C(OC)=O)CC4=CN(CC5=CC=CC=C5)C=N4