beta-Cedrene

Description: beta-Cedrene ((+)-beta-Cedrene), a sesquiterpene isolated from both Centaurea kotschyi var. kotschyi and Centaurea kotschyi var. decumbens, exhibits a broad range of biological activities, including antibacterial, anti-inflammatory, antispasmodic, tonic, diuretic, sedative, insecticidal, and antifungal properties. Additionally, beta-Cedrene acts as a potent competitive inhibitor of the CYP2B6-mediated bupropion hydroxylase activity, demonstrating a K i value of 1.6 µM [1] [2]. Target: Others. Smiles: C[C@H]1[C@@]23[C@](C(C)(C)[C@@](C2)(C(=C)CC3)[H])(CC1)[H]