9(E),11(E)-9-nitro Conjugated Linoleic Acid

Description: 9(E),11(E)-9-nitro Conjugated Linoleic Acid (9E,11E-9-nitro CLA) is a nitrated fatty acid produced from 9Z,11E-CLA through exposure to acidified nitrite, peroxynitrite, gaseous nitrogen dioxide, or the combined action of myeloperoxidase, hydrogen peroxide, and nitrite. Additionally, it forms in LPS-stimulated RAW 264.7 macrophages, a process that can be inhibited by the nitric oxide synthase (NOS) inhibitor L-NAME. This compound has also been detected in human plasma. Target: Others. Smiles: C(\CCCCCCCC(O)=O)(=C\C=C\CCCCCC)/N(=O)=O