7-keto-25-hydroxy Cholesterol

Description: 7-Keto-25-hydroxy Cholesterol, an oxysterol and proposed metabolite of 7-keto cholesterol and 7-dehydro cholesterol, binds to and activates Smoothened (Smo) at the conserved extracellular cysteine-rich domain (CRD) in a reporter assay. Additionally, it enhances the number of EGF high affinity binding sites in normal rat kidney (NRK) cells. Target: Others. Smiles: C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@H](O)CC1=CC3=O