4-FPBUA

Description: 4-FPBUA, a semi-synthetic analog of lichen acid, enhances the functionality of cell-based blood-brain barriers (BBB) and increases the transport of beta-amyloid (Abeta) in monolayer cells. Additionally, it acts as an inhibitor of mTOR, enhancing cellular autophagy (Autophagy) which can reverse BBB disruption in vivo, making it relevant for research in Alzheimer's disease. Target: mTOR, Autophagy. Smiles: C[C@]12C=3C(OC1=CC(O)=C(C(C)=O)C2=O)=C(C(/C=C/C4=CC=C(C=C4)C5=CC=C(F)C=C5)=O)C(O)=C(C)C3O