(2S,3R)-H-Abu(3-N3)-OH hydrochloride

Description: (2S,3R)-H-Abu(3-N3)-OH (hydrochloride) is a click chemistry reagent containing an azide group. This compound can undergo a copper-catalyzed azide-alkyne cycloaddition reaction (CuAAC) with molecules that possess an alkyne group. Additionally, it is capable of engaging in strain-promoted alkyne-azide cycloaddition reactions (SPAAC) with molecules that have DBCO or BCN groups. Target: ADC Linker. Smiles: [C@H]([C@H](N=[N+]=[N-])C)(C(O)=O)N.Cl