2'-Deoxyadenosine-5'-triphosphate

Description: 2'-Deoxyadenosine-5'-triphosphate (Deoxyadenosine 5-triphosphate) (dATP) is a naturally occurring small molecule nucleotide used in cells for DNA synthesis or replication. 2'-Deoxyadenosine-5'-triphosphate (dATP) is a substrate for DNA polymerase. 2'-Deoxyadenosine-5'-triphosphate (dATP) is an inhibitor of RNA through an inactive alpha4beta4 quaternary structure. Deoxyadenosine-5'-triphosphate inhibits RNA through the inactive alpha4beta4 quaternary structure.2'-Deoxyadenosine-5'-triphosphate has been associated with cardiomyocyte growth. Target: Endogenous Metabolite, DNA/RNA Synthesis. Smiles: Nc1ncnc2n(cnc12)[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1