16alpha-Hydroxy-17beta-estradiol-2,4-d2

Description: 16alpha-Hydroxy-17beta-estradiol-2,4-d2 is a deuterated compound of Estriol. Estriol has a CAS number of 50-27-1. Estriol is a hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, a large amount of estriol is produced by the PLACENTA. Smiles: C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=C(C(O)=C(C4)[2H])[2H])(CC1)[H])[H])(C[C@@H](O)[C@@H]2O)[H]