1-thio-beta-D-Glucose (sodium salt)

Description: 1-thio-beta-D-Glucose is an analog of beta-D-glucose in which sulfur replaces the hydroxyl group at the one position. The thiol group allows diverse chemical reactions, including click chemistry and polymerization. 1-thio-beta-D-Glucose can be labeled with technetium-99m for analytical and diagnostic procedures. It can also be used as a substrate for glucose oxidase, which leads to the production of 1-thio-beta-D-gluconic acid. Target: Others. Smiles: [Na+].OC[C@H]1O[C@@H]([S-])[C@H](O)[C@@H](O)[C@@H]1O