Zu "K13049" wurden 6 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Oleoyl Glutamine
Artikelnummer: Cay28922-1
N-Oleoyl glutamine is an endogenous N-acyl amine. It is both formed and degraded by peptidase M20 domain-containing 1 (PM20D1), a factor secreted by thermogenic adipose cells. N-Oleoyl glutamine (50 µM) induces mitochondrial uncoupling to increase respiration in C2C12 cells by 64%. It inhibits capsaicin-induced...
| Schlagworte: | N2-[(9Z)-1-oxo-9-octadecen-1-yl]-L-glutamine |
| Anwendung: | Endogenous N-acyl amine |
| CAS | 247150-73-8 |
| MW: | 410.6 D |
ab 89,00 €
N-Oleoyl Glutamine
Artikelnummer: TGM-T36064-100mg
Description: N-Oleoyl Glutamine (Oleoyl-L-glutamine) is an N-acyl amino acid involved in the regulation of PM20D1 and antagonizes TRPV1 of the transient receptor potential (TRP) calcium channel. Target: TRP/TRPV Channel. Smiles: [C@H](NC(CCCCCCC/C=C\CCCCCCCC)=O)(CCC(N)=O)C(O)=O. References: Long, J.Z., Svensson,...
| Schlagworte: | Oleoyl-L-glutamine |
| Anwendung: | Endogenous N-acyl amine |
| CAS | 247150-73-8 |
| MW: | 410.59 D |
ab 102,00 €
Anti-P20D1
Artikelnummer: ELK-ES14340.100
Protein function: Secreted enzyme that regulates the endogenous N-fatty acyl amino acid (NAAs) tissue and circulating levels by functioning as a bidirectional NAA synthase/hydrolase (PubMed:27374330). It condenses free fatty acids and free amino acids to generate NAAs and bidirectionally catalyzes the reverse...
| Schlagworte: | Anti-Peptidase M20 domain-containing protein 1, Anti-N-fatty-acyl-amino acid synthase/hydrolase PM20D1, P20D1 rabbit pAb |
| Anwendung: | WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | human, mouse |
ab 173,00 €
PM20D1 (Vector pUC, Accession No. BC063477)
Artikelnummer: CSB-CL760682HU.10
Length: 1509 Sequence: atggctcagc ggtgcgtttg cgtgctggcc ctggtggcta tgctgctcct agttttccct accgtctcca gatcgatggg cccgaggagc ggggagcatc aaagggcgtc gcgaatccct tctcagttca gcaaagagga acgcgtcgcg atgaaagagg cgctgaaagg tgccatccag attccaacag tgacttttag ctctgagaag tccaatacta cagccctggc tgagttcgga aaatacattc ataaagtctt...
| Schlagworte: | Peptidase M20 domain-containing protein 1, N-fatty-acyl-amino acid synthase/hydrolase PM20D1 |
| Anwendung: | Molecular biology, clone |
| Spezies-Reaktivität: | human |
556,00 €
Anti-pm20d1.2
Artikelnummer: CSB-PA600173XA01DIL.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-pm20d1.2, Anti-Peptidase M20 domain-containing protein 1.2, Anti-N-fatty-acyl-amino acid synthase/hydrolase PM20D1.2,... |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Danio rerio (Zebrafish) (Brachydanio rerio) |
ab 1.529,00 €
Anti-pm20d1.1
Artikelnummer: CSB-PA657669XA01DIL.100
Make to order. Production time: 70-80 business days. Deliverables: 1. 200 µg antigen (used as positive control), 2. 1 ml pre-immune serum (used as negative control) , 3. Rabbit polyclonal antibody, antigen affinity purified. Quality Guarantee: 1. Antibody purity > 90% confirmed by SDS-PAGE, 2. Antibody titer > 1:...
| Schlagworte: | Anti-Peptidase M20 domain-containing protein 1.1, Anti-N-fatty-acyl-amino acid synthase/hydrolase PM20D1.1, pm20d1.1 Antibody |
| Anwendung: | ELISA, WB |
| Wirt: | Rabbit |
| Spezies-Reaktivität: | Danio rerio (Zebrafish) (Brachydanio rerio) |
ab 1.529,00 €