LYP-IN-1

Description: LYP-IN-1 is a potent and highly selective inhibitor of lymphoid-specific tyrosine phosphatase (LYP), with a Ki value of 110 nM and an IC50 of 0.259 µM. LYP-IN-1 exhibits additional selectivity against a broad range of PTPs, including SHP1 (IC50 = 5 µM) and SHP2 (IC50 = 2.5 µM). LYP-IN-1 demonstrates strong efficacy in both T cells and mast cells, making it a valuable compound for research into autoimmune disorders and immune signaling pathways. Target: Phosphatase. Smiles: OC(=O)c1cc2c(C#Cc3cccc(Cl)c3)c(oc2cc1O)-c1ccc(OCC(=O)NC2CC2)cc1